C13H14F8O4 — CID 91692789
1-O-[(E)-but-2-enyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate (PubChem CID 91692789) has the molecular formula C13H14F8O4 and a molecular weight of 386.24 g/mol. Its IUPAC name is 1-O-[(E)-but-2-enyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate.
| Compound Name | 1-O-[(E)-but-2-enyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
|---|---|
| PubChem CID | 91692789 |
| Molecular Formula | C13H14F8O4 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 1-O-[(E)-but-2-enyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
| SMILES | C/C=C/COC(=O)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H14F8O4/c1-2-3-6-24-8(22)4-5-9(23)25-7-11(16,17)13(20,21)12(18,19)10(14)15/h2-3,10H,4-7H2,1H3/b3-2+ |
| InChIKey | NXUYBENKVTZHKJ-NSCUHMNNSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|