C16H27Cl3O4 — CID 91692835
1-O-(2-methylpropyl) 10-O-(2,2,2-trichloroethyl) decanedioate (PubChem CID 91692835) has the molecular formula C16H27Cl3O4 and a molecular weight of 389.75 g/mol. Its IUPAC name is 1-O-(2-methylpropyl) 10-O-(2,2,2-trichloroethyl) decanedioate.
| Compound Name | 1-O-(2-methylpropyl) 10-O-(2,2,2-trichloroethyl) decanedioate |
|---|---|
| PubChem CID | 91692835 |
| Molecular Formula | C16H27Cl3O4 |
| Molecular Weight | 389.75 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-O-(2-methylpropyl) 10-O-(2,2,2-trichloroethyl) decanedioate |
| SMILES | CC(C)COC(=O)CCCCCCCCC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H27Cl3O4/c1-13(2)11-22-14(20)9-7-5-3-4-6-8-10-15(21)23-12-16(17,18)19/h13H,3-12H2,1-2H3 |
| InChIKey | AAKADIBGIUAMMB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.75 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|