About butyl 2-ethylhexyl carbonate
butyl 2-ethylhexyl carbonate (PubChem CID 91693071) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is butyl 2-ethylhexyl carbonate.
Molecular Properties
| Compound Name | butyl 2-ethylhexyl carbonate |
| PubChem CID | 91693071 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | butyl 2-ethylhexyl carbonate |
| SMILES | CCCCOC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C13H26O3/c1-4-7-9-12(6-3)11-16-13(14)15-10-8-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | DGCRQNVSIHHFIC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-ethylhexyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-ethylhexyl carbonate?
The IUPAC name of butyl 2-ethylhexyl carbonate (CID 91693071) is butyl 2-ethylhexyl carbonate.
What is the SMILES notation for butyl 2-ethylhexyl carbonate?
The canonical SMILES for butyl 2-ethylhexyl carbonate is CCCCOC(=O)OCC(CC)CCCC.
What is the InChIKey of butyl 2-ethylhexyl carbonate?
The InChIKey is DGCRQNVSIHHFIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3/c1-4-7-9-12(6-3)11-16-13(14)15-10-8-5-2/h12H,4-11H2,1-3H3.
What are the key properties of butyl 2-ethylhexyl carbonate?
butyl 2-ethylhexyl carbonate has a molecular weight of 230.35 g/mol, XLogP of 4.16, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-ethylhexyl carbonate is sourced from PubChem (CID 91693071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).