C17H32O5 — CID 91693160
pentyl 2-[2-oxo-2-(2,4,4-trimethylpentoxy)ethoxy]acetate (PubChem CID 91693160) has the molecular formula C17H32O5 and a molecular weight of 316.44 g/mol. Its IUPAC name is pentyl 2-[2-oxo-2-(2,4,4-trimethylpentoxy)ethoxy]acetate.
| Compound Name | pentyl 2-[2-oxo-2-(2,4,4-trimethylpentoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 91693160 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | pentyl 2-[2-oxo-2-(2,4,4-trimethylpentoxy)ethoxy]acetate |
| SMILES | CCCCCOC(=O)COCC(=O)OCC(C)CC(C)(C)C |
| InChI | InChI=1S/C17H32O5/c1-6-7-8-9-21-15(18)12-20-13-16(19)22-11-14(2)10-17(3,4)5/h14H,6-13H2,1-5H3 |
| InChIKey | MLMDXCIBAOURAE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|