C22H41NO4 — CID 91693186
2-ethylhexyl 2-(2-ethylhexoxycarbonylamino)pent-4-enoate (PubChem CID 91693186) has the molecular formula C22H41NO4 and a molecular weight of 383.57 g/mol. Its IUPAC name is 2-ethylhexyl 2-(2-ethylhexoxycarbonylamino)pent-4-enoate.
| Compound Name | 2-ethylhexyl 2-(2-ethylhexoxycarbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 91693186 |
| Molecular Formula | C22H41NO4 |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.30 |
| IUPAC Name | 2-ethylhexyl 2-(2-ethylhexoxycarbonylamino)pent-4-enoate |
| SMILES | C=CCC(NC(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C22H41NO4/c1-6-11-14-18(9-4)16-26-21(24)20(13-8-3)23-22(25)27-17-19(10-5)15-12-7-2/h8,18-20H,3,6-7,9-17H2,1-2,4-5H3,(H,23,25) |
| InChIKey | BRNMVQGNMCWOAX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|