About [(E)-dodec-2-enyl] 2-methylpropyl carbonate
[(E)-dodec-2-enyl] 2-methylpropyl carbonate (PubChem CID 91693299) has the molecular formula C17H32O3
and a molecular weight of 284.44 g/mol. Its IUPAC name is [(E)-dodec-2-enyl] 2-methylpropyl carbonate.
Molecular Properties
| Compound Name | [(E)-dodec-2-enyl] 2-methylpropyl carbonate |
| PubChem CID | 91693299 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | [(E)-dodec-2-enyl] 2-methylpropyl carbonate |
| SMILES | CCCCCCCCC/C=C/COC(=O)OCC(C)C |
| InChI | InChI=1S/C17H32O3/c1-4-5-6-7-8-9-10-11-12-13-14-19-17(18)20-15-16(2)3/h12-13,16H,4-11,14-15H2,1-3H3/b13-12+ |
| InChIKey | IHPXQNPACYRMLD-OUKQBFOZSA-N |
| XLogP | 5.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-dodec-2-enyl] 2-methylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-dodec-2-enyl] 2-methylpropyl carbonate?
The IUPAC name of [(E)-dodec-2-enyl] 2-methylpropyl carbonate (CID 91693299) is [(E)-dodec-2-enyl] 2-methylpropyl carbonate.
What is the SMILES notation for [(E)-dodec-2-enyl] 2-methylpropyl carbonate?
The canonical SMILES for [(E)-dodec-2-enyl] 2-methylpropyl carbonate is CCCCCCCCC/C=C/COC(=O)OCC(C)C.
What is the InChIKey of [(E)-dodec-2-enyl] 2-methylpropyl carbonate?
The InChIKey is IHPXQNPACYRMLD-OUKQBFOZSA-N. The full InChI is InChI=1S/C17H32O3/c1-4-5-6-7-8-9-10-11-12-13-14-19-17(18)20-15-16(2)3/h12-13,16H,4-11,14-15H2,1-3H3/b13-12+.
What are the key properties of [(E)-dodec-2-enyl] 2-methylpropyl carbonate?
[(E)-dodec-2-enyl] 2-methylpropyl carbonate has a molecular weight of 284.44 g/mol, XLogP of 5.49, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-dodec-2-enyl] 2-methylpropyl carbonate is sourced from PubChem (CID 91693299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).