C24H42O4 — CID 91693356
1-O-[(E)-dodec-2-enyl] 4-O-(2,4,4-trimethylpentyl) (E)-but-2-enedioate (PubChem CID 91693356) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is 1-O-[(E)-dodec-2-enyl] 4-O-(2,4,4-trimethylpentyl) (E)-but-2-enedioate.
| Compound Name | 1-O-[(E)-dodec-2-enyl] 4-O-(2,4,4-trimethylpentyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91693356 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 1-O-[(E)-dodec-2-enyl] 4-O-(2,4,4-trimethylpentyl) (E)-but-2-enedioate |
| SMILES | CCCCCCCCC/C=C/COC(=O)/C=C/C(=O)OCC(C)CC(C)(C)C |
| InChI | InChI=1S/C24H42O4/c1-6-7-8-9-10-11-12-13-14-15-18-27-22(25)16-17-23(26)28-20-21(2)19-24(3,4)5/h14-17,21H,6-13,18-20H2,1-5H3/b15-14+,17-16+ |
| InChIKey | PJGVABQJYMGKNQ-JLXBFWJWSA-N |
| XLogP | 6.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|