About bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate
bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate (PubChem CID 91693646) has the molecular formula C21H40O6
and a molecular weight of 388.55 g/mol. Its IUPAC name is bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate.
Molecular Properties
| Compound Name | bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate |
| PubChem CID | 91693646 |
| Molecular Formula | C21H40O6 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)OC(C)COC(C)(C)C)C(=O)OC(C)COC(C)(C)C |
| InChI | InChI=1S/C21H40O6/c1-11-21(12-2,17(22)26-15(3)13-24-19(5,6)7)18(23)27-16(4)14-25-20(8,9)10/h15-16H,11-14H2,1-10H3 |
| InChIKey | VRGDRQIILBDECD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate?
The IUPAC name of bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate (CID 91693646) is bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate.
What is the SMILES notation for bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate?
The canonical SMILES for bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate is CCC(CC)(C(=O)OC(C)COC(C)(C)C)C(=O)OC(C)COC(C)(C)C.
What is the InChIKey of bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate?
The InChIKey is VRGDRQIILBDECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O6/c1-11-21(12-2,17(22)26-15(3)13-24-19(5,6)7)18(23)27-16(4)14-25-20(8,9)10/h15-16H,11-14H2,1-10H3.
What are the key properties of bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate?
bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate has a molecular weight of 388.55 g/mol, XLogP of 4.29, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 2,2-diethylpropanedioate is sourced from PubChem (CID 91693646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).