C19H26F8O4 — CID 91693704
4-O-(4-tert-butylcyclohexyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate (PubChem CID 91693704) has the molecular formula C19H26F8O4 and a molecular weight of 470.40 g/mol. Its IUPAC name is 4-O-(4-tert-butylcyclohexyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate.
| Compound Name | 4-O-(4-tert-butylcyclohexyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
|---|---|
| PubChem CID | 91693704 |
| Molecular Formula | C19H26F8O4 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-O-(4-tert-butylcyclohexyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
| SMILES | CC(C)(C)C1CCC(OC(=O)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C19H26F8O4/c1-16(2,3)11-4-6-12(7-5-11)31-14(29)9-8-13(28)30-10-17(22,23)19(26,27)18(24,25)15(20)21/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | ALFDCIGAPMNZBT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|