C12H22N2O — CID 91693893
N-[(4-methoxycyclohexa-1,4-dien-1-yl)methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 91693893) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[(4-methoxycyclohexa-1,4-dien-1-yl)methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(4-methoxycyclohexa-1,4-dien-1-yl)methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 91693893 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-[(4-methoxycyclohexa-1,4-dien-1-yl)methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | COC1=CCC(CNCCN(C)C)=CC1 |
| InChI | InChI=1S/C12H22N2O/c1-14(2)9-8-13-10-11-4-6-12(15-3)7-5-11/h4,7,13H,5-6,8-10H2,1-3H3 |
| InChIKey | MHDPVTCZYHOTAO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|