About Fenpropidin
Fenpropidin (PubChem CID 91694) has the molecular formula C19H31N
and a molecular weight of 273.50 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine.
Molecular Properties
| Compound Name | Fenpropidin |
| PubChem CID | 91694 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.50 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine |
| SMILES | CC(CC1=CC=C(C=C1)C(C)(C)C)CN2CCCCC2 |
| InChI | InChI=1S/C19H31N/c1-16(15-20-12-6-5-7-13-20)14-17-8-10-18(11-9-17)19(2,3)4/h8-11,16H,5-7,12-15H2,1-4H3 |
| InChIKey | MGNFYQILYYYUBS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | 264 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Fenpropidin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Fenpropidin?
The IUPAC name of Fenpropidin (CID 91694) is 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine.
What is the SMILES notation for Fenpropidin?
The canonical SMILES for Fenpropidin is CC(CC1=CC=C(C=C1)C(C)(C)C)CN2CCCCC2.
What is the InChIKey of Fenpropidin?
The InChIKey is MGNFYQILYYYUBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N/c1-16(15-20-12-6-5-7-13-20)14-17-8-10-18(11-9-17)19(2,3)4/h8-11,16H,5-7,12-15H2,1-4H3.
What are the key properties of Fenpropidin?
Fenpropidin has a molecular weight of 273.50 g/mol, XLogP of 5.50, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Fenpropidin is sourced from PubChem (CID 91694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).