C24H37F3O2Si — CID 91694248
3-[dimethyl(3,3,3-trifluoropropyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 91694248) has the molecular formula C24H37F3O2Si and a molecular weight of 442.64 g/mol. Its IUPAC name is 3-[dimethyl(3,3,3-trifluoropropyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 3-[dimethyl(3,3,3-trifluoropropyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 91694248 |
| Molecular Formula | C24H37F3O2Si |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 3-[dimethyl(3,3,3-trifluoropropyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC12CCC3C(CC=C4CC(O[Si](C)(C)CCC(F)(F)F)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C24H37F3O2Si/c1-22-11-9-17(29-30(3,4)14-13-24(25,26)27)15-16(22)5-6-18-19-7-8-21(28)23(19,2)12-10-20(18)22/h5,17-20H,6-15H2,1-4H3 |
| InChIKey | CTDJVVFETUOWMZ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|