About ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate
ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate (PubChem CID 91694293) has the molecular formula C9H14ClF2NO3S
and a molecular weight of 289.73 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate |
| PubChem CID | 91694293 |
| Molecular Formula | C9H14ClF2NO3S |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CCOC(=O)C(CCSC)NC(=O)C(F)(F)Cl |
| InChI | InChI=1S/C9H14ClF2NO3S/c1-3-16-7(14)6(4-5-17-2)13-8(15)9(10,11)12/h6H,3-5H2,1-2H3,(H,13,15) |
| InChIKey | OMNSGFAPMYNXHD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate?
The IUPAC name of ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate (CID 91694293) is ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate.
What is the SMILES notation for ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate?
The canonical SMILES for ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate is CCOC(=O)C(CCSC)NC(=O)C(F)(F)Cl.
What is the InChIKey of ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate?
The InChIKey is OMNSGFAPMYNXHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClF2NO3S/c1-3-16-7(14)6(4-5-17-2)13-8(15)9(10,11)12/h6H,3-5H2,1-2H3,(H,13,15).
What are the key properties of ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate?
ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate has a molecular weight of 289.73 g/mol, XLogP of 1.62, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-chloro-2,2-difluoroacetyl)amino]-4-methylsulfanylbutanoate is sourced from PubChem (CID 91694293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).