C10H11F7O2 — CID 91694375
[(Z)-hex-3-enyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91694375) has the molecular formula C10H11F7O2 and a molecular weight of 296.18 g/mol. Its IUPAC name is [(Z)-hex-3-enyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [(Z)-hex-3-enyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91694375 |
| Molecular Formula | C10H11F7O2 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | [(Z)-hex-3-enyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC/C=C\CCOC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F7O2/c1-2-3-4-5-6-19-7(18)8(11,12)9(13,14)10(15,16)17/h3-4H,2,5-6H2,1H3/b4-3- |
| InChIKey | IIKAVGQGNAGAMG-ARJAWSKDSA-N |
| XLogP | 3.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|