C12H13F7O2 — CID 91694396
2-bicyclo[2.2.1]heptanylmethyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91694396) has the molecular formula C12H13F7O2 and a molecular weight of 322.22 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanylmethyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 2-bicyclo[2.2.1]heptanylmethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91694396 |
| Molecular Formula | C12H13F7O2 |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanylmethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OCC1CC2CCC1C2)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F7O2/c13-10(14,11(15,16)12(17,18)19)9(20)21-5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2 |
| InChIKey | ZWHGCVUKPJCHFO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|