C17H26F4O4 — CID 91694503
1-O-[(E)-dec-4-enyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate (PubChem CID 91694503) has the molecular formula C17H26F4O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-O-[(E)-dec-4-enyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate.
| Compound Name | 1-O-[(E)-dec-4-enyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91694503 |
| Molecular Formula | C17H26F4O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-O-[(E)-dec-4-enyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
| SMILES | CCCCC/C=C/CCCOC(=O)CCC(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C17H26F4O4/c1-2-3-4-5-6-7-8-9-12-24-14(22)10-11-15(23)25-13-17(20,21)16(18)19/h6-7,16H,2-5,8-13H2,1H3/b7-6+ |
| InChIKey | NWFACMPTTPKZMG-VOTSOKGWSA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|