About 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate
4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate (PubChem CID 91694548) has the molecular formula C19H34O4
and a molecular weight of 326.48 g/mol. Its IUPAC name is 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate |
| PubChem CID | 91694548 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate |
| SMILES | CCCCC/C=C/CCCOC(=O)CCC(=O)OCCCCC |
| InChI | InChI=1S/C19H34O4/c1-3-5-7-8-9-10-11-13-17-23-19(21)15-14-18(20)22-16-12-6-4-2/h9-10H,3-8,11-17H2,1-2H3/b10-9+ |
| InChIKey | LEDXXTSJOKKQIZ-MDZDMXLPSA-N |
| XLogP | 4.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate?
The IUPAC name of 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate (CID 91694548) is 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate.
What is the SMILES notation for 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate?
The canonical SMILES for 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate is CCCCC/C=C/CCCOC(=O)CCC(=O)OCCCCC.
What is the InChIKey of 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate?
The InChIKey is LEDXXTSJOKKQIZ-MDZDMXLPSA-N. The full InChI is InChI=1S/C19H34O4/c1-3-5-7-8-9-10-11-13-17-23-19(21)15-14-18(20)22-16-12-6-4-2/h9-10H,3-8,11-17H2,1-2H3/b10-9+.
What are the key properties of 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate?
4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate has a molecular weight of 326.48 g/mol, XLogP of 4.96, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[(E)-dec-4-enyl] 1-O-pentyl butanedioate is sourced from PubChem (CID 91694548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).