C10H10F7NO3 — CID 91694700
2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl 2-methylprop-2-enoate (PubChem CID 91694700) has the molecular formula C10H10F7NO3 and a molecular weight of 325.18 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91694700 |
| Molecular Formula | C10H10F7NO3 |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F7NO3/c1-5(2)6(19)21-4-3-18-7(20)8(11,12)9(13,14)10(15,16)17/h1,3-4H2,2H3,(H,18,20) |
| InChIKey | VDGOHEAHOOZDMN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|