About 4-methylpentan-2-yl 2,2,2-trifluoroacetate
4-methylpentan-2-yl 2,2,2-trifluoroacetate (PubChem CID 91694716) has the molecular formula C8H13F3O2
and a molecular weight of 198.18 g/mol. Its IUPAC name is 4-methylpentan-2-yl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 4-methylpentan-2-yl 2,2,2-trifluoroacetate |
| PubChem CID | 91694716 |
| Molecular Formula | C8H13F3O2 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-methylpentan-2-yl 2,2,2-trifluoroacetate |
| SMILES | CC(C)CC(C)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H13F3O2/c1-5(2)4-6(3)13-7(12)8(9,10)11/h5-6H,4H2,1-3H3 |
| InChIKey | IIOPUKBKIYREOI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpentan-2-yl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-yl 2,2,2-trifluoroacetate?
The IUPAC name of 4-methylpentan-2-yl 2,2,2-trifluoroacetate (CID 91694716) is 4-methylpentan-2-yl 2,2,2-trifluoroacetate.
What is the SMILES notation for 4-methylpentan-2-yl 2,2,2-trifluoroacetate?
The canonical SMILES for 4-methylpentan-2-yl 2,2,2-trifluoroacetate is CC(C)CC(C)OC(=O)C(F)(F)F.
What is the InChIKey of 4-methylpentan-2-yl 2,2,2-trifluoroacetate?
The InChIKey is IIOPUKBKIYREOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3O2/c1-5(2)4-6(3)13-7(12)8(9,10)11/h5-6H,4H2,1-3H3.
What are the key properties of 4-methylpentan-2-yl 2,2,2-trifluoroacetate?
4-methylpentan-2-yl 2,2,2-trifluoroacetate has a molecular weight of 198.18 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-yl 2,2,2-trifluoroacetate is sourced from PubChem (CID 91694716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).