C20H23F15O2 — CID 91694721
[(E)-dodec-2-enyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (PubChem CID 91694721) has the molecular formula C20H23F15O2 and a molecular weight of 580.37 g/mol. Its IUPAC name is [(E)-dodec-2-enyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate.
| Compound Name | [(E)-dodec-2-enyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
|---|---|
| PubChem CID | 91694721 |
| Molecular Formula | C20H23F15O2 |
| Molecular Weight | 580.37 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | [(E)-dodec-2-enyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| SMILES | CCCCCCCCC/C=C/COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H23F15O2/c1-2-3-4-5-6-7-8-9-10-11-12-37-13(36)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)35/h10-11H,2-9,12H2,1H3/b11-10+ |
| InChIKey | FCYHFDRVVBWMKF-ZHACJKMWSA-N |
| XLogP | 8.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.37 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|