C16H28F8O2Si — CID 91694859
dimethyl-nonoxy-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane (PubChem CID 91694859) has the molecular formula C16H28F8O2Si and a molecular weight of 432.47 g/mol. Its IUPAC name is dimethyl-nonoxy-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane.
| Compound Name | dimethyl-nonoxy-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane |
|---|---|
| PubChem CID | 91694859 |
| Molecular Formula | C16H28F8O2Si |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | dimethyl-nonoxy-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane |
| SMILES | CCCCCCCCCO[Si](C)(C)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H28F8O2Si/c1-4-5-6-7-8-9-10-11-25-27(2,3)26-12-14(19,20)16(23,24)15(21,22)13(17)18/h13H,4-12H2,1-3H3 |
| InChIKey | YTMVWKPSUUIRPN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|