C17H25F3O4 — CID 91694936
1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate (PubChem CID 91694936) has the molecular formula C17H25F3O4 and a molecular weight of 350.38 g/mol. Its IUPAC name is 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate.
| Compound Name | 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
|---|---|
| PubChem CID | 91694936 |
| Molecular Formula | C17H25F3O4 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)CCC(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C17H25F3O4/c1-12(2)6-5-7-13(3)10-11-23-15(21)8-9-16(22)24-14(4)17(18,19)20/h6,10,14H,5,7-9,11H2,1-4H3/b13-10+ |
| InChIKey | XSNRVDTXUWIVPF-JLHYYAGUSA-N |
| XLogP | 4.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|