C17H24F4O4 — CID 91694939
1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate (PubChem CID 91694939) has the molecular formula C17H24F4O4 and a molecular weight of 368.37 g/mol. Its IUPAC name is 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate.
| Compound Name | 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91694939 |
| Molecular Formula | C17H24F4O4 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)CCC(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C17H24F4O4/c1-12(2)5-4-6-13(3)9-10-24-14(22)7-8-15(23)25-11-17(20,21)16(18)19/h5,9,16H,4,6-8,10-11H2,1-3H3/b13-9- |
| InChIKey | VTUSQBHLOIBRIV-LCYFTJDESA-N |
| XLogP | 4.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|