C19H24F8O4 — CID 91694940
1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate (PubChem CID 91694940) has the molecular formula C19H24F8O4 and a molecular weight of 468.38 g/mol. Its IUPAC name is 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate.
| Compound Name | 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
|---|---|
| PubChem CID | 91694940 |
| Molecular Formula | C19H24F8O4 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C19H24F8O4/c1-12(2)5-4-6-13(3)9-10-30-14(28)7-8-15(29)31-11-17(22,23)19(26,27)18(24,25)16(20)21/h5,9,16H,4,6-8,10-11H2,1-3H3/b13-9- |
| InChIKey | CPXDHJXBIGOBPU-LCYFTJDESA-N |
| XLogP | 5.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|