C18H27F3O4 — CID 91694942
1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate (PubChem CID 91694942) has the molecular formula C18H27F3O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate.
| Compound Name | 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
|---|---|
| PubChem CID | 91694942 |
| Molecular Formula | C18H27F3O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)CCCC(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C18H27F3O4/c1-13(2)7-5-8-14(3)11-12-24-16(22)9-6-10-17(23)25-15(4)18(19,20)21/h7,11,15H,5-6,8-10,12H2,1-4H3/b14-11+ |
| InChIKey | ZYDFPRXBORYNFO-SDNWHVSQSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|