C28H48O2 — CID 91694960
[(2E)-3,7-dimethylocta-2,6-dienyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 91694960) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 91694960 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C28H48O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-28(29)30-25-24-27(4)22-20-21-26(2)3/h9-10,12-13,21,24H,5-8,11,14-20,22-23,25H2,1-4H3/b10-9-,13-12-,27-24+ |
| InChIKey | SDVRIIKZIMWDSJ-BUWFTCIHSA-N |
| XLogP | 9.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|