C15H24F6O2 — CID 91694992
(4S,5S)-4-ethyl-5-octyl-2,2-bis(trifluoromethyl)-1,3-dioxolane (PubChem CID 91694992) has the molecular formula C15H24F6O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is (4S,5S)-4-ethyl-5-octyl-2,2-bis(trifluoromethyl)-1,3-dioxolane.
| Compound Name | (4S,5S)-4-ethyl-5-octyl-2,2-bis(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 91694992 |
| Molecular Formula | C15H24F6O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (4S,5S)-4-ethyl-5-octyl-2,2-bis(trifluoromethyl)-1,3-dioxolane |
| SMILES | CCCCCCCC[C@@H]1OC(C(F)(F)F)(C(F)(F)F)O[C@H]1CC |
| InChI | InChI=1S/C15H24F6O2/c1-3-5-6-7-8-9-10-12-11(4-2)22-13(23-12,14(16,17)18)15(19,20)21/h11-12H,3-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | RXIWGHFITFXAAR-RYUDHWBXSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|