C8F16N2O — CID 91695023
2-[2,2,3,3,5,5,6,6,7,7-decafluoro-4-(trifluoromethyl)-1,4-diazepan-1-yl]-2,2-difluoroacetyl fluoride (PubChem CID 91695023) has the molecular formula C8F16N2O and a molecular weight of 444.07 g/mol. Its IUPAC name is 2-[2,2,3,3,5,5,6,6,7,7-decafluoro-4-(trifluoromethyl)-1,4-diazepan-1-yl]-2,2-difluoroacetyl fluoride.
| Compound Name | 2-[2,2,3,3,5,5,6,6,7,7-decafluoro-4-(trifluoromethyl)-1,4-diazepan-1-yl]-2,2-difluoroacetyl fluoride |
|---|---|
| PubChem CID | 91695023 |
| Molecular Formula | C8F16N2O |
| Molecular Weight | 444.07 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | 2-[2,2,3,3,5,5,6,6,7,7-decafluoro-4-(trifluoromethyl)-1,4-diazepan-1-yl]-2,2-difluoroacetyl fluoride |
| SMILES | O=C(F)C(F)(F)N1C(F)(F)C(F)(F)N(C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8F16N2O/c9-1(27)2(10,11)25-4(14,15)3(12,13)5(16,17)26(8(22,23)24)7(20,21)6(25,18)19 |
| InChIKey | CEYWCUZNMXKYEE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.07 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|