C16H17Cl3O4 — CID 91695101
1-O-(3-methylbut-2-enyl) 5-O-(2,3,5-trichlorophenyl) pentanedioate (PubChem CID 91695101) has the molecular formula C16H17Cl3O4 and a molecular weight of 379.67 g/mol. Its IUPAC name is 1-O-(3-methylbut-2-enyl) 5-O-(2,3,5-trichlorophenyl) pentanedioate.
| Compound Name | 1-O-(3-methylbut-2-enyl) 5-O-(2,3,5-trichlorophenyl) pentanedioate |
|---|---|
| PubChem CID | 91695101 |
| Molecular Formula | C16H17Cl3O4 |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 1-O-(3-methylbut-2-enyl) 5-O-(2,3,5-trichlorophenyl) pentanedioate |
| SMILES | CC(C)=CCOC(=O)CCCC(=O)Oc1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C16H17Cl3O4/c1-10(2)6-7-22-14(20)4-3-5-15(21)23-13-9-11(17)8-12(18)16(13)19/h6,8-9H,3-5,7H2,1-2H3 |
| InChIKey | WLLUXPJYISLAHX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|