About 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate
4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate (PubChem CID 91695148) has the molecular formula C19H34O4
and a molecular weight of 326.48 g/mol. Its IUPAC name is 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate.
Molecular Properties
| Compound Name | 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate |
| PubChem CID | 91695148 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate |
| SMILES | CCCCC/C=C/CCOC(=O)CCC(=O)OC(CC)C(C)C |
| InChI | InChI=1S/C19H34O4/c1-5-7-8-9-10-11-12-15-22-18(20)13-14-19(21)23-17(6-2)16(3)4/h10-11,16-17H,5-9,12-15H2,1-4H3/b11-10+ |
| InChIKey | HJLZFFAPNPNQGI-ZHACJKMWSA-N |
| XLogP | 4.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate?
The IUPAC name of 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate (CID 91695148) is 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate.
What is the SMILES notation for 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate?
The canonical SMILES for 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate is CCCCC/C=C/CCOC(=O)CCC(=O)OC(CC)C(C)C.
What is the InChIKey of 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate?
The InChIKey is HJLZFFAPNPNQGI-ZHACJKMWSA-N. The full InChI is InChI=1S/C19H34O4/c1-5-7-8-9-10-11-12-15-22-18(20)13-14-19(21)23-17(6-2)16(3)4/h10-11,16-17H,5-9,12-15H2,1-4H3/b11-10+.
What are the key properties of 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate?
4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate has a molecular weight of 326.48 g/mol, XLogP of 4.81, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-methylpentan-3-yl) 1-O-[(E)-non-3-enyl] butanedioate is sourced from PubChem (CID 91695148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).