C10H5F9O7 — CID 91695197
[4,5-bis[(2,2,2-trifluoroacetyl)oxy]oxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 91695197) has the molecular formula C10H5F9O7 and a molecular weight of 408.13 g/mol. Its IUPAC name is [4,5-bis[(2,2,2-trifluoroacetyl)oxy]oxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4,5-bis[(2,2,2-trifluoroacetyl)oxy]oxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91695197 |
| Molecular Formula | C10H5F9O7 |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | [4,5-bis[(2,2,2-trifluoroacetyl)oxy]oxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC1COC(OC(=O)C(F)(F)F)C1OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H5F9O7/c11-8(12,13)5(20)24-2-1-23-4(26-7(22)10(17,18)19)3(2)25-6(21)9(14,15)16/h2-4H,1H2 |
| InChIKey | RKEXFFCZGAODQO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|