C12H5F9O9 — CID 91695268
[5-oxo-2,6-bis[(2,2,2-trifluoroacetyl)oxy]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 91695268) has the molecular formula C12H5F9O9 and a molecular weight of 464.15 g/mol. Its IUPAC name is [5-oxo-2,6-bis[(2,2,2-trifluoroacetyl)oxy]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [5-oxo-2,6-bis[(2,2,2-trifluoroacetyl)oxy]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91695268 |
| Molecular Formula | C12H5F9O9 |
| Molecular Weight | 464.15 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | [5-oxo-2,6-bis[(2,2,2-trifluoroacetyl)oxy]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C1OC2C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)OC2C1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H5F9O9/c13-10(14,15)7(23)28-3-1-2(26-5(3)22)4(29-8(24)11(16,17)18)6(27-1)30-9(25)12(19,20)21/h1-4,6H |
| InChIKey | JTNJEXCWPOHXIX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.15 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|