C15H10F12O10 — CID 91695330
ethyl 2,3,4,5-tetrakis[(2,2,2-trifluoroacetyl)oxy]pentanoate (PubChem CID 91695330) has the molecular formula C15H10F12O10 and a molecular weight of 578.21 g/mol. Its IUPAC name is ethyl 2,3,4,5-tetrakis[(2,2,2-trifluoroacetyl)oxy]pentanoate.
| Compound Name | ethyl 2,3,4,5-tetrakis[(2,2,2-trifluoroacetyl)oxy]pentanoate |
|---|---|
| PubChem CID | 91695330 |
| Molecular Formula | C15H10F12O10 |
| Molecular Weight | 578.21 g/mol |
| Exact Mass | 578.01 |
| IUPAC Name | ethyl 2,3,4,5-tetrakis[(2,2,2-trifluoroacetyl)oxy]pentanoate |
| SMILES | CCOC(=O)C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(COC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H10F12O10/c1-2-33-7(28)6(37-11(32)15(25,26)27)5(36-10(31)14(22,23)24)4(35-9(30)13(19,20)21)3-34-8(29)12(16,17)18/h4-6H,2-3H2,1H3 |
| InChIKey | WVHYAYUKCNQOSN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|