C17H31NO2 — CID 91695465
(7Z)-6-methyl-7-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)heptane-2,3-diol (PubChem CID 91695465) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (7Z)-6-methyl-7-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)heptane-2,3-diol.
| Compound Name | (7Z)-6-methyl-7-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)heptane-2,3-diol |
|---|---|
| PubChem CID | 91695465 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (7Z)-6-methyl-7-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)heptane-2,3-diol |
| SMILES | CC(/C=C1/CC(C)C2CCCN2C1)CCC(O)C(C)O |
| InChI | InChI=1S/C17H31NO2/c1-12(6-7-17(20)14(3)19)9-15-10-13(2)16-5-4-8-18(16)11-15/h9,12-14,16-17,19-20H,4-8,10-11H2,1-3H3/b15-9- |
| InChIKey | SUMJLKAYPQXQGL-DHDCSXOGSA-N |
| XLogP | 2.58 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|