C11H16Cl2O4 — CID 91695503
4-O-(2,2-dichloroethyl) 1-O-pentyl (E)-but-2-enedioate (PubChem CID 91695503) has the molecular formula C11H16Cl2O4 and a molecular weight of 283.15 g/mol. Its IUPAC name is 4-O-(2,2-dichloroethyl) 1-O-pentyl (E)-but-2-enedioate.
| Compound Name | 4-O-(2,2-dichloroethyl) 1-O-pentyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91695503 |
| Molecular Formula | C11H16Cl2O4 |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-O-(2,2-dichloroethyl) 1-O-pentyl (E)-but-2-enedioate |
| SMILES | CCCCCOC(=O)/C=C/C(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C11H16Cl2O4/c1-2-3-4-7-16-10(14)5-6-11(15)17-8-9(12)13/h5-6,9H,2-4,7-8H2,1H3/b6-5+ |
| InChIKey | XMQDRXJXGJNOAC-AATRIKPKSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|