About 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate
2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate (PubChem CID 91695785) has the molecular formula C14H26O5
and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate.
Molecular Properties
| Compound Name | 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate |
| PubChem CID | 91695785 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate |
| SMILES | CCC(C)COC(=O)COCC(=O)OCC(C)CC |
| InChI | InChI=1S/C14H26O5/c1-5-11(3)7-18-13(15)9-17-10-14(16)19-8-12(4)6-2/h11-12H,5-10H2,1-4H3 |
| InChIKey | QKBABHZCAXPULQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate?
The IUPAC name of 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate (CID 91695785) is 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate.
What is the SMILES notation for 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate?
The canonical SMILES for 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate is CCC(C)COC(=O)COCC(=O)OCC(C)CC.
What is the InChIKey of 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate?
The InChIKey is QKBABHZCAXPULQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O5/c1-5-11(3)7-18-13(15)9-17-10-14(16)19-8-12(4)6-2/h11-12H,5-10H2,1-4H3.
What are the key properties of 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate?
2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate has a molecular weight of 274.36 g/mol, XLogP of 2.18, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl 2-[2-(2-methylbutoxy)-2-oxoethoxy]acetate is sourced from PubChem (CID 91695785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).