About 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate
1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate (PubChem CID 91695808) has the molecular formula C17H30O5
and a molecular weight of 314.42 g/mol. Its IUPAC name is 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate.
Molecular Properties
| Compound Name | 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate |
| PubChem CID | 91695808 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate |
| SMILES | CCCCCOC(=O)C(CC)(CC)C(=O)OCC1CCCO1 |
| InChI | InChI=1S/C17H30O5/c1-4-7-8-11-21-15(18)17(5-2,6-3)16(19)22-13-14-10-9-12-20-14/h14H,4-13H2,1-3H3 |
| InChIKey | IMLKFDBVHWPKQR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate?
The IUPAC name of 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate (CID 91695808) is 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate.
What is the SMILES notation for 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate?
The canonical SMILES for 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate is CCCCCOC(=O)C(CC)(CC)C(=O)OCC1CCCO1.
What is the InChIKey of 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate?
The InChIKey is IMLKFDBVHWPKQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O5/c1-4-7-8-11-21-15(18)17(5-2,6-3)16(19)22-13-14-10-9-12-20-14/h14H,4-13H2,1-3H3.
What are the key properties of 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate?
1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate has a molecular weight of 314.42 g/mol, XLogP of 3.25, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(oxolan-2-ylmethyl) 3-O-pentyl 2,2-diethylpropanedioate is sourced from PubChem (CID 91695808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).