C17H31NO4 — CID 91696071
hexyl 2-(2,2-dimethylpropoxycarbonylamino)pent-4-enoate (PubChem CID 91696071) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is hexyl 2-(2,2-dimethylpropoxycarbonylamino)pent-4-enoate.
| Compound Name | hexyl 2-(2,2-dimethylpropoxycarbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 91696071 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | hexyl 2-(2,2-dimethylpropoxycarbonylamino)pent-4-enoate |
| SMILES | C=CCC(NC(=O)OCC(C)(C)C)C(=O)OCCCCCC |
| InChI | InChI=1S/C17H31NO4/c1-6-8-9-10-12-21-15(19)14(11-7-2)18-16(20)22-13-17(3,4)5/h7,14H,2,6,8-13H2,1,3-5H3,(H,18,20) |
| InChIKey | KOFTVJNWUWMLIE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|