C34H44N2O5 — CID 91696114
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-(2-oxopropanoylamino)naphthalene-2-carboxamide (PubChem CID 91696114) has the molecular formula C34H44N2O5 and a molecular weight of 560.74 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-(2-oxopropanoylamino)naphthalene-2-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-(2-oxopropanoylamino)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 91696114 |
| Molecular Formula | C34H44N2O5 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-(2-oxopropanoylamino)naphthalene-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(NC(=O)C(C)=O)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C34H44N2O5/c1-8-33(4,5)23-16-17-29(27(20-23)34(6,7)9-2)41-19-13-12-18-35-32(40)26-21-28(36-31(39)22(3)37)24-14-10-11-15-25(24)30(26)38/h10-11,14-17,20-21,38H,8-9,12-13,18-19H2,1-7H3,(H,35,40)(H,36,39) |
| InChIKey | MDEUAHGOXHJJPQ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|