C40H52N4O4 — CID 91696251
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-[2-carbamoyl-4-(dimethylamino)anilino]-1-hydroxynaphthalene-2-carboxamide (PubChem CID 91696251) has the molecular formula C40H52N4O4 and a molecular weight of 652.88 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-[2-carbamoyl-4-(dimethylamino)anilino]-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-[2-carbamoyl-4-(dimethylamino)anilino]-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 91696251 |
| Molecular Formula | C40H52N4O4 |
| Molecular Weight | 652.88 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-[2-carbamoyl-4-(dimethylamino)anilino]-1-hydroxynaphthalene-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(Nc3ccc(N(C)C)cc3C(N)=O)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C40H52N4O4/c1-9-39(3,4)26-17-20-35(32(23-26)40(5,6)10-2)48-22-14-13-21-42-38(47)31-25-34(28-15-11-12-16-29(28)36(31)45)43-33-19-18-27(44(7)8)24-30(33)37(41)46/h11-12,15-20,23-25,43,45H,9-10,13-14,21-22H2,1-8H3,(H2,41,46)(H,42,47) |
| InChIKey | JWVGAAAOSIFJFZ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.88 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|