C35H46N2O6 — CID 91696287
[2-[[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]amino]-2-oxoethyl] acetate (PubChem CID 91696287) has the molecular formula C35H46N2O6 and a molecular weight of 590.76 g/mol. Its IUPAC name is [2-[[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]amino]-2-oxoethyl] acetate.
| Compound Name | [2-[[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 91696287 |
| Molecular Formula | C35H46N2O6 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | [2-[[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]amino]-2-oxoethyl] acetate |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(NC(=O)COC(C)=O)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C35H46N2O6/c1-8-34(4,5)24-16-17-30(28(20-24)35(6,7)9-2)42-19-13-12-18-36-33(41)27-21-29(37-31(39)22-43-23(3)38)25-14-10-11-15-26(25)32(27)40/h10-11,14-17,20-21,40H,8-9,12-13,18-19,22H2,1-7H3,(H,36,41)(H,37,39) |
| InChIKey | HPGNUEDZICYURX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|