C15H21I3N2O2Si — CID 91696293
trimethylsilyl 3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoate (PubChem CID 91696293) has the molecular formula C15H21I3N2O2Si and a molecular weight of 670.14 g/mol. Its IUPAC name is trimethylsilyl 3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoate.
| Compound Name | trimethylsilyl 3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoate |
|---|---|
| PubChem CID | 91696293 |
| Molecular Formula | C15H21I3N2O2Si |
| Molecular Weight | 670.14 g/mol |
| Exact Mass | 669.85 |
| IUPAC Name | trimethylsilyl 3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoate |
| SMILES | CN(C)/C=N/c1c(I)cc(I)c(CCC(=O)O[Si](C)(C)C)c1I |
| InChI | InChI=1S/C15H21I3N2O2Si/c1-20(2)9-19-15-12(17)8-11(16)10(14(15)18)6-7-13(21)22-23(3,4)5/h8-9H,6-7H2,1-5H3/b19-9+ |
| InChIKey | PVJDUVDDIQHJFU-DJKKODMXSA-N |
| XLogP | 5.03 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|