C19H22Cl6O2Si2 — CID 91696372
trimethyl-[3,4,6-trichloro-2-[(2,3,5-trichloro-6-trimethylsilyloxyphenyl)methyl]phenoxy]silane (PubChem CID 91696372) has the molecular formula C19H22Cl6O2Si2 and a molecular weight of 551.27 g/mol. Its IUPAC name is trimethyl-[3,4,6-trichloro-2-[(2,3,5-trichloro-6-trimethylsilyloxyphenyl)methyl]phenoxy]silane.
| Compound Name | trimethyl-[3,4,6-trichloro-2-[(2,3,5-trichloro-6-trimethylsilyloxyphenyl)methyl]phenoxy]silane |
|---|---|
| PubChem CID | 91696372 |
| Molecular Formula | C19H22Cl6O2Si2 |
| Molecular Weight | 551.27 g/mol |
| Exact Mass | 547.93 |
| IUPAC Name | trimethyl-[3,4,6-trichloro-2-[(2,3,5-trichloro-6-trimethylsilyloxyphenyl)methyl]phenoxy]silane |
| SMILES | C[Si](C)(C)Oc1c(Cl)cc(Cl)c(Cl)c1Cc1c(Cl)c(Cl)cc(Cl)c1O[Si](C)(C)C |
| InChI | InChI=1S/C19H22Cl6O2Si2/c1-28(2,3)26-18-10(16(24)12(20)8-14(18)22)7-11-17(25)13(21)9-15(23)19(11)27-29(4,5)6/h8-9H,7H2,1-6H3 |
| InChIKey | ZDANJYHVODGEOG-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.27 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|