C20H32OSi — CID 91696433
[(9Z)-heptadeca-1,9-dien-4,6-diyn-3-yl]oxy-trimethylsilane (PubChem CID 91696433) has the molecular formula C20H32OSi and a molecular weight of 316.56 g/mol. Its IUPAC name is [(9Z)-heptadeca-1,9-dien-4,6-diyn-3-yl]oxy-trimethylsilane.
| Compound Name | [(9Z)-heptadeca-1,9-dien-4,6-diyn-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91696433 |
| Molecular Formula | C20H32OSi |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [(9Z)-heptadeca-1,9-dien-4,6-diyn-3-yl]oxy-trimethylsilane |
| SMILES | C=CC(C#CC#CC/C=C\CCCCCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C20H32OSi/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20(7-2)21-22(3,4)5/h7,13-14,20H,2,6,8-12,15H2,1,3-5H3/b14-13- |
| InChIKey | WDWDEHVCHBVQLN-YPKPFQOOSA-N |
| XLogP | 5.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|