C19H47NO5Si4 — CID 91696658
(E)-N-ethoxy-1,3,4,5-tetrakis(trimethylsilyloxy)pentan-2-imine (PubChem CID 91696658) has the molecular formula C19H47NO5Si4 and a molecular weight of 481.93 g/mol. Its IUPAC name is (E)-N-ethoxy-1,3,4,5-tetrakis(trimethylsilyloxy)pentan-2-imine.
| Compound Name | (E)-N-ethoxy-1,3,4,5-tetrakis(trimethylsilyloxy)pentan-2-imine |
|---|---|
| PubChem CID | 91696658 |
| Molecular Formula | C19H47NO5Si4 |
| Molecular Weight | 481.93 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (E)-N-ethoxy-1,3,4,5-tetrakis(trimethylsilyloxy)pentan-2-imine |
| SMILES | CCO/N=C(\CO[Si](C)(C)C)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H47NO5Si4/c1-14-21-20-17(15-22-26(2,3)4)19(25-29(11,12)13)18(24-28(8,9)10)16-23-27(5,6)7/h18-19H,14-16H2,1-13H3/b20-17+ |
| InChIKey | FLOGXRXPOPAKAT-LVZFUZTISA-N |
| XLogP | 5.52 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.93 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|