C22H40O4Si — CID 91696843
methyl (12E,15E)-10-oxo-9-trimethylsilyloxyoctadeca-12,15-dienoate (PubChem CID 91696843) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is methyl (12E,15E)-10-oxo-9-trimethylsilyloxyoctadeca-12,15-dienoate.
| Compound Name | methyl (12E,15E)-10-oxo-9-trimethylsilyloxyoctadeca-12,15-dienoate |
|---|---|
| PubChem CID | 91696843 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | methyl (12E,15E)-10-oxo-9-trimethylsilyloxyoctadeca-12,15-dienoate |
| SMILES | CC/C=C/C/C=C/CC(=O)C(CCCCCCCC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C22H40O4Si/c1-6-7-8-9-11-14-17-20(23)21(26-27(3,4)5)18-15-12-10-13-16-19-22(24)25-2/h7-8,11,14,21H,6,9-10,12-13,15-19H2,1-5H3/b8-7+,14-11+ |
| InChIKey | DIJNJKCAUPXEGO-DQBULIGTSA-N |
| XLogP | 5.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|