C26H46O4Si2 — CID 91697008
trimethylsilyl (E)-7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]hept-5-enoate (PubChem CID 91697008) has the molecular formula C26H46O4Si2 and a molecular weight of 478.82 g/mol. Its IUPAC name is trimethylsilyl (E)-7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]hept-5-enoate.
| Compound Name | trimethylsilyl (E)-7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 91697008 |
| Molecular Formula | C26H46O4Si2 |
| Molecular Weight | 478.82 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | trimethylsilyl (E)-7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]hept-5-enoate |
| SMILES | CCCCC[C@@H](/C=C/C1=C(C/C=C/CCCC(=O)O[Si](C)(C)C)C(=O)CC1)O[Si](C)(C)C |
| InChI | InChI=1S/C26H46O4Si2/c1-8-9-12-15-23(29-31(2,3)4)20-18-22-19-21-25(27)24(22)16-13-10-11-14-17-26(28)30-32(5,6)7/h10,13,18,20,23H,8-9,11-12,14-17,19,21H2,1-7H3/b13-10+,20-18+/t23-/m0/s1 |
| InChIKey | JZVGPLINNCXVJI-HGKKCHJLSA-N |
| XLogP | 7.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.82 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|