C15H37N5OSi4 — CID 91697023
2-N,2-N,4-N-tris(trimethylsilyl)-6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine (PubChem CID 91697023) has the molecular formula C15H37N5OSi4 and a molecular weight of 415.84 g/mol. Its IUPAC name is 2-N,2-N,4-N-tris(trimethylsilyl)-6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N-tris(trimethylsilyl)-6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91697023 |
| Molecular Formula | C15H37N5OSi4 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 2-N,2-N,4-N-tris(trimethylsilyl)-6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine |
| SMILES | C[Si](C)(C)Nc1nc(O[Si](C)(C)C)nc(N([Si](C)(C)C)[Si](C)(C)C)n1 |
| InChI | InChI=1S/C15H37N5OSi4/c1-22(2,3)19-13-16-14(18-15(17-13)21-25(10,11)12)20(23(4,5)6)24(7,8)9/h1-12H3,(H,16,17,18,19) |
| InChIKey | YKIPAHHTPYIDFW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|