C27H46O4Si — CID 91697027
methyl (E)-7-[2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate (PubChem CID 91697027) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is methyl (E)-7-[2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate.
| Compound Name | methyl (E)-7-[2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 91697027 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | methyl (E)-7-[2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate |
| SMILES | CCCCC[C@@H](/C=C/C1=C(C/C=C/CCCC(=O)OC)C(=O)CC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46O4Si/c1-8-9-12-15-23(31-32(6,7)27(2,3)4)20-18-22-19-21-25(28)24(22)16-13-10-11-14-17-26(29)30-5/h10,13,18,20,23H,8-9,11-12,14-17,19,21H2,1-7H3/b13-10+,20-18+/t23-/m0/s1 |
| InChIKey | UXKFMHKQLPKDME-HGKKCHJLSA-N |
| XLogP | 7.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|