C21H46N4O2Si3 — CID 91697032
N-[tert-butyl(dimethyl)silyl]-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3,5-triazin-2-amine (PubChem CID 91697032) has the molecular formula C21H46N4O2Si3 and a molecular weight of 470.88 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3,5-triazin-2-amine.
| Compound Name | N-[tert-butyl(dimethyl)silyl]-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 91697032 |
| Molecular Formula | C21H46N4O2Si3 |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3,5-triazin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)Nc1nc(O[Si](C)(C)C(C)(C)C)nc(O[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C21H46N4O2Si3/c1-19(2,3)28(10,11)25-16-22-17(26-29(12,13)20(4,5)6)24-18(23-16)27-30(14,15)21(7,8)9/h1-15H3,(H,22,23,24,25) |
| InChIKey | BSJKSDNYSKROIA-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|